Molecular Definition

Canonical SMILES NC1=CC(=O)c2ccc(nc2C1=O)c3cccc(n3)C(=O)O
Formula C15H9N3O4
Molecular Weight 295.25 da
Stereocenters 0/0