Molecular Definition

Canonical SMILES CCC(=O)NC(c1occc1)c2cc(Cl)c3cccnc3c2O
Formula C17H15ClN2O3
Molecular Weight 330.77 da
Stereocenters 0/1