Molecular Definition

Canonical SMILES CC(C)Cn1ncc2C(=O)NC(=Nc12)[C@@H]3CN(Cc4ccccc4)C[C@H]3C
Formula C21H27N5O
Molecular Weight 365.47 da
Stereocenters 2/2