Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2ncc(cc12)c3ccc(OC)nc3)NCC(=O)O
Formula C20H23N5O5
Molecular Weight 413.43 da
Stereocenters 0/0