Molecular Definition

Canonical SMILES ONC(=O)CCCCCC(c1c[nH]c2ccccc12)c3c[nH]c4ccccc34
Formula C23H25N3O2
Molecular Weight 375.46 da
Stereocenters 0/0