Molecular Definition

Canonical SMILES CC1(C)C[C@@H]2C[C@@](C)(CN2CCN3CCN(C3=O)c4cccc(Cl)c4)C1
Formula C21H30ClN3O
Molecular Weight 375.94 da
Stereocenters 2/2