Target Relevance

Molecular Definition

Canonical SMILES CCCCOc1cc(nc(c1)c2ccccc2)C(=O)N[C@@H](CCC(=O)O)C(=O)N3CCN(CC3)C(=O)OCC=C
Formula C29H36N4O7
Molecular Weight 552.62 da
Stereocenters 1/1