Molecular Definition

Canonical SMILES COc1ccc(Cn2cc(CC(NS(=O)(=O)c3ccc(OCC#CC)cc3)C(=O)O)c4cc(C)ccc24)cc1
Formula C30H30N2O6S
Molecular Weight 546.63 da
Stereocenters 0/1