Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1OCCN2CCOCC2)c3nc4N(C)C(=O)N(C)C(=O)c4[nH]3
Formula C20H25N5O5
Molecular Weight 415.44 da
Stereocenters 0/0