Target Relevance

Molecular Definition

Canonical SMILES C\C(=C/C=C/1\OC(=O)C=C1C)\CC[C@H]2[C@](C)(O)C[C@@H]3OC(=O)[C@]4(C)CCC[C@@]2(C)[C@@H]34
Formula C25H34O5
Molecular Weight 414.53 da
Stereocenters 6/6