Molecular Definition

Canonical SMILES CC(C)(O)C#Cc1ccc2c(c1)c3cc(Cl)ccc3c4nc([nH]c24)c5c(cccc5C#N)C#N
Formula C28H17ClN4O
Molecular Weight 460.91 da
Stereocenters 0/0