Target Relevance

Molecular Definition

Canonical SMILES CCO[C@H]1O[C@H]2C[C@@](C)(O)[C@H](CC\C(=C\C[C@H]3OC(=O)C=C3C)\C)[C@@]4(C)CCC[C@]1(C)[C@H]24
Formula C27H42O5
Molecular Weight 446.62 da
Stereocenters 8/8