Molecular Definition

Canonical SMILES CN(CC(=O)NC(c1ccccc1Cl)c2cc(Cl)c3cccnc3c2O)c4ccccc4
Formula C25H21Cl2N3O2
Molecular Weight 466.36 da
Stereocenters 0/1