Molecular Definition

Canonical SMILES Oc1c(cc(c2cccnc12)[N+](=O)[O-])C(NC(=O)COc3ccccc3)c4ccccc4Cl
Formula C24H18ClN3O5
Molecular Weight 463.87 da
Stereocenters 0/1