Target Relevance

Molecular Definition

Canonical SMILES O=C(C1CC(CN(C1)C(=O)c2cccc3ccccc23)c4ccccc4)N5CCC6(CC5)C=Cc7ccccc67
Formula C36H34N2O2
Molecular Weight 526.67 da
Stereocenters 0/2