Molecular Definition

Canonical SMILES CN(CCC(=O)N)C[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2c(C)nc3c(N)ncnc23
Formula C15H23N7O4
Molecular Weight 365.39 da
Stereocenters 4/4