Target Relevance

Molecular Definition

Canonical SMILES COc1cc2nccc(Oc3ccc(cc3F)C4=CN=C(Cc5ccccc5)N(C)C4=O)c2cc1OC
Formula C29H24FN3O4
Molecular Weight 497.52 da
Stereocenters 0/0