Target Relevance

Molecular Definition

Canonical SMILES Nc1nccc(n1)c2ccc3nc(oc3c2)C4COc5ccccc5C4
Formula C20H16N4O2
Molecular Weight 344.37 da
Stereocenters 0/1