Molecular Definition

Canonical SMILES CNc1nc2c(N)ncnc2n1[C@@H]3O[C@H](CN(C)CCON)[C@@H](O)[C@H]3O.OS(=O)(=O)O
Formula C14H26N8O8S
Molecular Weight 466.47 da
Stereocenters 4/4