Molecular Definition

Canonical SMILES CC#CCOc1ccc(cc1)S(=O)(=O)N[C@H](Cc2cn(Cc3ccccc3c4ccccc4)c5ccccc25)C(=O)O
Formula C34H30N2O5S
Molecular Weight 578.68 da
Stereocenters 1/1