Molecular Definition

Canonical SMILES Nc1cccc(c1)c2onc(c2)C(=O)NCCCCC(=O)NO
Formula C15H18N4O4
Molecular Weight 318.33 da
Stereocenters 0/0