Molecular Definition

Canonical SMILES COc1cc2c(Oc3ccc(cc3F)C4=CN=C(Cc5ccc(F)cc5)N(C)C4=O)ccnc2cc1OCCCN6CCOCC6
Formula C35H34F2N4O5
Molecular Weight 628.67 da
Stereocenters 0/0