Target Relevance

Molecular Definition

Canonical SMILES CC[C@H](C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CCCNC(=N)N)NC(=O)C(CC)CC)C(=O)N[C@@H](CCCCN)C(=O)N
Formula C48H78N14O8
Molecular Weight 979.22 da
Stereocenters 7/7