Molecular Definition

Canonical SMILES CC(C)c1cc(Oc2c(Br)cc(CC(=O)N[C@H](C)C(=O)O)cc2Br)ccc1O
Formula C20H21Br2NO5
Molecular Weight 515.19 da
Stereocenters 1/1