Target Relevance

Molecular Definition

Canonical SMILES CC(C)c1ccc(cc1S(=O)(=O)C)C(=O)N=C(N)N
Formula C12H17N3O3S
Molecular Weight 283.35 da
Stereocenters 0/0