Molecular Definition

Canonical SMILES OB(O)[C@H]1CCCN1C(=O)CNC2C3CC4CC(CC2C4)C3
Formula C16H27BN2O3
Molecular Weight 306.21 da
Stereocenters 1/1