Molecular Definition

Canonical SMILES CCCCCC(=O)\C=C\C=C/C\C=C/C\C=C/CCCC(=O)O
Formula C20H30O3
Molecular Weight 318.45 da
Stereocenters 0/0