Molecular Definition

Canonical SMILES CCOC(=O)C1CCCC(C1)C(CC(=O)NO)S(=O)(=O)c2ccc(OC)cc2
Formula C19H27NO7S
Molecular Weight 413.49 da
Stereocenters 0/3