Target Relevance

Molecular Definition

Canonical SMILES C[C@@H]1CC[C@@]2(OC1)O[C@H]3C[C@H]4[C@@H]5CC=C6C[C@H](CC[C@]6(C)[C@H]5CC[C@]4(C)[C@H]3[C@@H]2C)O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O
Formula C33H52O8
Molecular Weight 576.76 da
Stereocenters 16/16