Molecular Definition

Canonical SMILES OC(=O)c1ccc(CN2C(=O)S\C(=C/c3ccc(Oc4ccccc4)cc3)\C2=O)cc1
Formula C24H17NO5S
Molecular Weight 431.46 da
Stereocenters 0/0