Molecular Definition

Canonical SMILES COc1ccccc1CCNC(=O)c2cc(Oc3c(Br)cc(CC(=O)O)cc3Br)ccc2O
Formula C24H21Br2NO6
Molecular Weight 579.24 da
Stereocenters 0/0