Target Relevance

Molecular Definition

Canonical SMILES [Na+].C[C@H](CCC\C(=C\Cc1cc(O)ccc1O)\C)[C@@H](C[C@H]2C(=CC[C@H]3C(C)(C)CCC[C@]23C)C)OS(=O)(=O)[O-]
Formula C31H47NaO6S
Molecular Weight 570.76 da
Stereocenters 5/5