Target Relevance

Molecular Definition

Canonical SMILES C[C@@H](N1[C@H](C(=O)N(CCCCC(=O)O)c2ccc(I)cc2C1=O)c3ccc(cc3)C(F)(F)F)c4ccc(Cl)cc4
Formula C29H25ClF3IN2O4
Molecular Weight 684.87 da
Stereocenters 2/2