Target Relevance

Molecular Definition

Canonical SMILES C[C@@H](c1ccc2NC(=O)Sc2c1)c3ccn(n3)c4ccccn4
Formula C17H14N4OS
Molecular Weight 322.38 da
Stereocenters 1/1