Molecular Definition

Canonical SMILES CN1CCN(CC1)\C=C\2/CCN3C2=NC(=O)c4c(Cl)cccc34
Formula C17H19ClN4O
Molecular Weight 330.81 da
Stereocenters 0/0