Molecular Definition

Canonical SMILES Oc1ccccc1C(=O)\C=C\N2CCc3c(C2)ncnc3NC4CC4
Formula C19H20N4O2
Molecular Weight 336.39 da
Stereocenters 0/0