Molecular Definition

Canonical SMILES CC12CC3(C)CC(C)(C1)CC(C3)(C2)NCC(=O)N4CCC[C@@H]4B(O)O
Formula C19H33BN2O3
Molecular Weight 348.29 da
Stereocenters 1/1