Target Relevance

Molecular Definition

Canonical SMILES CCNC(=O)c1cccc(OCCCCN2CCN(CC2)c3cccc(Cl)c3Cl)c1
Formula C23H29Cl2N3O2
Molecular Weight 450.40 da
Stereocenters 0/0