Molecular Definition

Canonical SMILES O=C(Nc1ccc(cc1)c2nnc3CCCCCn23)\C=C\c4cccnc4
Formula C21H21N5O
Molecular Weight 359.42 da
Stereocenters 0/0