Molecular Definition

Canonical SMILES C(Nc1ccc2[nH]nc(c3nc4cc(ccc4[nH]3)N5CCC(CC5)N6CCCCC6)c2c1)C7CCCCC7
Formula C31H41N7
Molecular Weight 511.70 da
Stereocenters 0/0