Molecular Definition

Canonical SMILES CCC[C@@H]1C[C@@H]2C[C@]13Cc4cc(O)ccc4C3=C(C)C2=O
Formula C19H22O2
Molecular Weight 282.38 da
Stereocenters 3/3