Molecular Definition

Canonical SMILES CCN(CCN(C)C)C(=O)CNCc1cc(ccn1)C(=O)O
Formula C15H24N4O3
Molecular Weight 308.38 da
Stereocenters 0/0