Molecular Definition

Canonical SMILES CC(=O)Nc1nc(C)c(s1)c2ccc(Cl)c(c2)S(=O)(=O)Nc3ccc(F)cc3
Formula C18H15ClFN3O3S2
Molecular Weight 439.91 da
Stereocenters 0/0