Molecular Definition

Canonical SMILES CC(C)COc1cccc(Oc2cc3N(C)C(=O)N(C)c3cc2NS(=O)(=O)C4CC4)c1
Formula C22H27N3O5S
Molecular Weight 445.53 da
Stereocenters 0/0