Target Relevance

Molecular Definition

Canonical SMILES OB(O)c1ccc(Cn2c(nc3c(cccc23)[N+](=O)[O-])C(F)(F)F)cc1
Formula C15H11BF3N3O4
Molecular Weight 365.07 da
Stereocenters 0/0