Molecular Definition

Canonical SMILES O=C(N[C@H]1CNC1=O)OCCCCC2CCCCC2
Formula C14H24N2O3
Molecular Weight 268.35 da
Stereocenters 1/1