Molecular Definition

Canonical SMILES COc1ccc(CCCCOC(=O)N[C@H]2CNC2=O)cc1
Formula C15H20N2O4
Molecular Weight 292.33 da
Stereocenters 1/1