Target Relevance

Molecular Definition

Canonical SMILES Cc1n[nH]c(C)c1CCn2c(C)nc3c(c(Cl)c(Cl)cc23)[N+](=O)[O-]
Formula C15H15Cl2N5O2
Molecular Weight 368.22 da
Stereocenters 0/0