Molecular Definition

Canonical SMILES OC(=O)CN(C1(CCC1)c2cccc(c2)c3ccc(Cl)cc3Cl)S(=O)(=O)c4ccc(Cl)c(Cl)c4
Formula C24H19Cl4NO4S
Molecular Weight 559.29 da
Stereocenters 0/0