Molecular Definition

Canonical SMILES Nc1ncc(cc1c2ccc(Cl)cc2)C3=CC(=O)NC=C3
Formula C16H12ClN3O
Molecular Weight 297.74 da
Stereocenters 0/0